C17H18N6S — CID 135906661
14-(piperidin-1-ylmethyl)-2-thia-9,12,13,15,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,11,13,16-heptaene (PubChem CID 135906661) has the molecular formula C17H18N6S and a molecular weight of 338.44 g/mol. Its IUPAC name is 14-(piperidin-1-ylmethyl)-2-thia-9,12,13,15,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,11,13,16-heptaene.
| Compound Name | 14-(piperidin-1-ylmethyl)-2-thia-9,12,13,15,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,11,13,16-heptaene |
|---|---|
| PubChem CID | 135906661 |
| Molecular Formula | C17H18N6S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 14-(piperidin-1-ylmethyl)-2-thia-9,12,13,15,16-pentazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,11,13,16-heptaene |
| SMILES | c1ccc2c(c1)Nc1c(cnn3c(CN4CCCCC4)nnc13)S2 |
| InChI | InChI=1S/C17H18N6S/c1-4-8-22(9-5-1)11-15-20-21-17-16-14(10-18-23(15)17)24-13-7-3-2-6-12(13)19-16/h2-3,6-7,10,19H,1,4-5,8-9,11H2 |
| InChIKey | HIMQJSDZXBZXES-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |