C17H19ClN6O2S — CID 135906712
2-[(6-tert-butyl-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 135906712) has the molecular formula C17H19ClN6O2S and a molecular weight of 406.90 g/mol. Its IUPAC name is 2-[(6-tert-butyl-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[(6-tert-butyl-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 135906712 |
| Molecular Formula | C17H19ClN6O2S |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 2-[(6-tert-butyl-7-oxo-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CSc1nnc2[nH]c(=O)c(C(C)(C)C)nn12 |
| InChI | InChI=1S/C17H19ClN6O2S/c1-9-10(18)6-5-7-11(9)19-12(25)8-27-16-22-21-15-20-14(26)13(17(2,3)4)23-24(15)16/h5-7H,8H2,1-4H3,(H,19,25)(H,20,21,26) |
| InChIKey | GGUTYMAZLQCXLK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |