C11H11N3O2S — CID 135906753
(4R,6R)-4-thiophen-2-yl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylic acid (PubChem CID 135906753) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is (4R,6R)-4-thiophen-2-yl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylic acid.
| Compound Name | (4R,6R)-4-thiophen-2-yl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 135906753 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (4R,6R)-4-thiophen-2-yl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylic acid |
| SMILES | O=C(O)[C@H]1Cc2nc[nH]c2[C@H](c2cccs2)N1 |
| InChI | InChI=1S/C11H11N3O2S/c15-11(16)7-4-6-9(13-5-12-6)10(14-7)8-2-1-3-17-8/h1-3,5,7,10,14H,4H2,(H,12,13)(H,15,16)/t7-,10+/m1/s1 |
| InChIKey | AOYPUEQTXLZQGC-XCBNKYQSSA-N |
| XLogP | 1.16 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |