C11H13N3O2S2 — CID 135908335
(NE)-N-[5-(4-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]methanesulfonamide (PubChem CID 135908335) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is (NE)-N-[5-(4-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]methanesulfonamide.
| Compound Name | (NE)-N-[5-(4-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]methanesulfonamide |
|---|---|
| PubChem CID | 135908335 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | (NE)-N-[5-(4-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]methanesulfonamide |
| SMILES | Cc1ccc(C2=NN/C(=N\S(C)(=O)=O)SC2)cc1 |
| InChI | InChI=1S/C11H13N3O2S2/c1-8-3-5-9(6-4-8)10-7-17-11(13-12-10)14-18(2,15)16/h3-6H,7H2,1-2H3,(H,13,14) |
| InChIKey | FVOFDSQQQVJSBT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|