About 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol
2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol (PubChem CID 135908529) has the molecular formula C22H16N2O2
and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol.
Molecular Properties
| Compound Name | 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol |
| PubChem CID | 135908529 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol |
| SMILES | CC1(c2ccccc2)N=c2ccc3c(O)c4ccccc4c(O)c3c2=N1 |
| InChI | InChI=1S/C22H16N2O2/c1-22(13-7-3-2-4-8-13)23-17-12-11-16-18(19(17)24-22)21(26)15-10-6-5-9-14(15)20(16)25/h2-12,25-26H,1H3 |
| InChIKey | PYOWYPPKLBIZJK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol?
The IUPAC name of 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol (CID 135908529) is 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol.
What is the SMILES notation for 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol?
The canonical SMILES for 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol is CC1(c2ccccc2)N=c2ccc3c(O)c4ccccc4c(O)c3c2=N1.
What is the InChIKey of 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol?
The InChIKey is PYOWYPPKLBIZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O2/c1-22(13-7-3-2-4-8-13)23-17-12-11-16-18(19(17)24-22)21(26)15-10-6-5-9-14(15)20(16)25/h2-12,25-26H,1H3.
What are the key properties of 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol?
2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol has a molecular weight of 340.38 g/mol, XLogP of 3.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-phenylnaphtho[3,2-e]benzimidazole-6,11-diol is sourced from PubChem (CID 135908529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).