C18H15F2N5O2 — CID 135909178
(13S)-13-(2,6-difluorophenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine (PubChem CID 135909178) has the molecular formula C18H15F2N5O2 and a molecular weight of 371.35 g/mol. Its IUPAC name is (13S)-13-(2,6-difluorophenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine.
| Compound Name | (13S)-13-(2,6-difluorophenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
|---|---|
| PubChem CID | 135909178 |
| Molecular Formula | C18H15F2N5O2 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (13S)-13-(2,6-difluorophenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
| SMILES | NC1=N[C@H](c2c(F)cccc2F)n2c(nc3cc4c(cc32)OCCCO4)N1 |
| InChI | InChI=1S/C18H15F2N5O2/c19-9-3-1-4-10(20)15(9)16-23-17(21)24-18-22-11-7-13-14(8-12(11)25(16)18)27-6-2-5-26-13/h1,3-4,7-8,16H,2,5-6H2,(H3,21,22,23,24)/t16-/m0/s1 |
| InChIKey | OMZIZHHXRTVTNK-INIZCTEOSA-N |
| XLogP | 2.76 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |