C29H31ClN4O4 — CID 135910358
5-[2-(2-chlorophenyl)pyrazol-3-yl]-2,4-dihydroxy-N-methyl-N-[[2-[2-(propan-2-ylamino)ethoxy]phenyl]methyl]benzamide (PubChem CID 135910358) has the molecular formula C29H31ClN4O4 and a molecular weight of 535.04 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)pyrazol-3-yl]-2,4-dihydroxy-N-methyl-N-[[2-[2-(propan-2-ylamino)ethoxy]phenyl]methyl]benzamide.
| Compound Name | 5-[2-(2-chlorophenyl)pyrazol-3-yl]-2,4-dihydroxy-N-methyl-N-[[2-[2-(propan-2-ylamino)ethoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 135910358 |
| Molecular Formula | C29H31ClN4O4 |
| Molecular Weight | 535.04 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 5-[2-(2-chlorophenyl)pyrazol-3-yl]-2,4-dihydroxy-N-methyl-N-[[2-[2-(propan-2-ylamino)ethoxy]phenyl]methyl]benzamide |
| SMILES | CC(C)NCCOc1ccccc1CN(C)C(=O)c1cc(-c2ccnn2-c2ccccc2Cl)c(O)cc1O |
| InChI | InChI=1S/C29H31ClN4O4/c1-19(2)31-14-15-38-28-11-7-4-8-20(28)18-33(3)29(37)22-16-21(26(35)17-27(22)36)24-12-13-32-34(24)25-10-6-5-9-23(25)30/h4-13,16-17,19,31,35-36H,14-15,18H2,1-3H3 |
| InChIKey | SXNJFKRFNLIHTI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.04 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|