C26H27N3O4 — CID 135910594
(4S)-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-methyl-1-(3-methylphenyl)-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-5-one (PubChem CID 135910594) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (4S)-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-methyl-1-(3-methylphenyl)-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-5-one.
| Compound Name | (4S)-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-methyl-1-(3-methylphenyl)-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 135910594 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (4S)-4-(4-hydroxy-3,5-dimethoxyphenyl)-3-methyl-1-(3-methylphenyl)-6,7,8,9-tetrahydro-4H-pyrazolo[5,4-b]quinolin-5-one |
| SMILES | COc1cc([C@@H]2C3=C(CCCC3=O)Nc3c2c(C)nn3-c2cccc(C)c2)cc(OC)c1O |
| InChI | InChI=1S/C26H27N3O4/c1-14-7-5-8-17(11-14)29-26-22(15(2)28-29)23(24-18(27-26)9-6-10-19(24)30)16-12-20(32-3)25(31)21(13-16)33-4/h5,7-8,11-13,23,27,31H,6,9-10H2,1-4H3/t23-/m0/s1 |
| InChIKey | JTMUJNCYFQNFQV-QHCPKHFHSA-N |
| XLogP | 4.78 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |