C17H18FN3O4S — CID 135910904
(2R,3R)-2-[[1-(4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-methylpentanoic acid (PubChem CID 135910904) has the molecular formula C17H18FN3O4S and a molecular weight of 379.41 g/mol. Its IUPAC name is (2R,3R)-2-[[1-(4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-methylpentanoic acid.
| Compound Name | (2R,3R)-2-[[1-(4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 135910904 |
| Molecular Formula | C17H18FN3O4S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (2R,3R)-2-[[1-(4-fluorophenyl)-6-hydroxy-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@@H](/N=C/c1c(O)n(-c2ccc(F)cc2)c(=S)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C17H18FN3O4S/c1-3-9(2)13(16(24)25)19-8-12-14(22)20-17(26)21(15(12)23)11-6-4-10(18)5-7-11/h4-9,13,23H,3H2,1-2H3,(H,24,25)(H,20,22,26)/b19-8+/t9-,13-/m1/s1 |
| InChIKey | OTHHPLCAVBXJNQ-LMCFTXQDSA-N |
| XLogP | 2.66 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|