About 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one
4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one (PubChem CID 135911048) has the molecular formula C21H21N3O2
and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one |
| PubChem CID | 135911048 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]c(O)c(/C=N/CCCN2CCc3ccccc32)c2ccccc12 |
| InChI | InChI=1S/C21H21N3O2/c25-20-17-8-3-2-7-16(17)18(21(26)23-20)14-22-11-5-12-24-13-10-15-6-1-4-9-19(15)24/h1-4,6-9,14H,5,10-13H2,(H2,23,25,26)/b22-14+ |
| InChIKey | GMHQJLJKHOIHEX-HYARGMPZSA-N |
| XLogP | 3.11 |
| TPSA | 68.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one?
The IUPAC name of 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one (CID 135911048) is 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one.
What is the SMILES notation for 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one?
The canonical SMILES for 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one is O=c1[nH]c(O)c(/C=N/CCCN2CCc3ccccc32)c2ccccc12.
What is the InChIKey of 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one?
The InChIKey is GMHQJLJKHOIHEX-HYARGMPZSA-N. The full InChI is InChI=1S/C21H21N3O2/c25-20-17-8-3-2-7-16(17)18(21(26)23-20)14-22-11-5-12-24-13-10-15-6-1-4-9-19(15)24/h1-4,6-9,14H,5,10-13H2,(H2,23,25,26)/b22-14+.
What are the key properties of 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one?
4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one has a molecular weight of 347.42 g/mol, XLogP of 3.11, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,3-dihydroindol-1-yl)propyliminomethyl]-3-hydroxy-2H-isoquinolin-1-one is sourced from PubChem (CID 135911048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).