C19H13FN4O2S — CID 135911631
11-(1,3-benzodioxol-5-yl)-4-fluoro-8-thia-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),3,5,13,15-hexaene (PubChem CID 135911631) has the molecular formula C19H13FN4O2S and a molecular weight of 380.40 g/mol. Its IUPAC name is 11-(1,3-benzodioxol-5-yl)-4-fluoro-8-thia-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),3,5,13,15-hexaene.
| Compound Name | 11-(1,3-benzodioxol-5-yl)-4-fluoro-8-thia-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),3,5,13,15-hexaene |
|---|---|
| PubChem CID | 135911631 |
| Molecular Formula | C19H13FN4O2S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 11-(1,3-benzodioxol-5-yl)-4-fluoro-8-thia-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2(7),3,5,13,15-hexaene |
| SMILES | Fc1ccc2c(c1)C1=C(CS2)C(c2ccc3c(c2)OCO3)n2ncnc2N1 |
| InChI | InChI=1S/C19H13FN4O2S/c20-11-2-4-16-12(6-11)17-13(7-27-16)18(24-19(23-17)21-8-22-24)10-1-3-14-15(5-10)26-9-25-14/h1-6,8,18H,7,9H2,(H,21,22,23) |
| InChIKey | AXOOPCPEZTWNKE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |