C30H31N7O3S — CID 135911720
N-(2-aminophenyl)-4-[1-[7-hydroxy-2-(2-morpholin-4-ylethylamino)-6H-pyrrolo[2,3-g][1,3]benzothiazol-8-yl]ethylideneamino]benzamide (PubChem CID 135911720) has the molecular formula C30H31N7O3S and a molecular weight of 569.69 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[1-[7-hydroxy-2-(2-morpholin-4-ylethylamino)-6H-pyrrolo[2,3-g][1,3]benzothiazol-8-yl]ethylideneamino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[1-[7-hydroxy-2-(2-morpholin-4-ylethylamino)-6H-pyrrolo[2,3-g][1,3]benzothiazol-8-yl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 135911720 |
| Molecular Formula | C30H31N7O3S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | N-(2-aminophenyl)-4-[1-[7-hydroxy-2-(2-morpholin-4-ylethylamino)-6H-pyrrolo[2,3-g][1,3]benzothiazol-8-yl]ethylideneamino]benzamide |
| SMILES | C/C(=N\c1ccc(C(=O)Nc2ccccc2N)cc1)c1c(O)[nH]c2ccc3nc(NCCN4CCOCC4)sc3c12 |
| InChI | InChI=1S/C30H31N7O3S/c1-18(33-20-8-6-19(7-9-20)28(38)34-22-5-3-2-4-21(22)31)25-26-23(35-29(25)39)10-11-24-27(26)41-30(36-24)32-12-13-37-14-16-40-17-15-37/h2-11,35,39H,12-17,31H2,1H3,(H,32,36)(H,34,38)/b33-18+ |
| InChIKey | DRGBFSXZYQOITJ-DPNNOFEESA-N |
| XLogP | 5.20 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|