C20H18N4O3S — CID 135911841
2-(3-benzylimino-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-4-yl)-4-methylphenol (PubChem CID 135911841) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-(3-benzylimino-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-4-yl)-4-methylphenol.
| Compound Name | 2-(3-benzylimino-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-4-yl)-4-methylphenol |
|---|---|
| PubChem CID | 135911841 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-(3-benzylimino-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-4-yl)-4-methylphenol |
| SMILES | Cc1ccc(O)c(N2/C(=N/Cc3ccccc3)NS(=O)(=O)c3cnccc32)c1 |
| InChI | InChI=1S/C20H18N4O3S/c1-14-7-8-18(25)17(11-14)24-16-9-10-21-13-19(16)28(26,27)23-20(24)22-12-15-5-3-2-4-6-15/h2-11,13,25H,12H2,1H3,(H,22,23) |
| InChIKey | ZMGZNKJJSSSNBI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|