C7H8N5O3- — CID 135911924
2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridine-6-carboxylate (PubChem CID 135911924) has the molecular formula C7H8N5O3- and a molecular weight of 210.17 g/mol. Its IUPAC name is 2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridine-6-carboxylate.
| Compound Name | 2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridine-6-carboxylate |
|---|---|
| PubChem CID | 135911924 |
| Molecular Formula | C7H8N5O3- |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-amino-4-oxo-5,6,7,8-tetrahydro-3H-pteridine-6-carboxylate |
| SMILES | Nc1nc2c(c(=O)[nH]1)NC(C(=O)[O-])CN2 |
| InChI | InChI=1S/C7H9N5O3/c8-7-11-4-3(5(13)12-7)10-2(1-9-4)6(14)15/h2,10H,1H2,(H,14,15)(H4,8,9,11,12,13)/p-1 |
| InChIKey | QSIYONWVWDSRRO-UHFFFAOYSA-M |
| XLogP | -2.69 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |