C9H16N5O8P-2 — CID 135911927
[(2R,3S,4S)-5-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]-2,3,4-trihydroxypentyl] phosphate (PubChem CID 135911927) has the molecular formula C9H16N5O8P-2 and a molecular weight of 353.23 g/mol. Its IUPAC name is [(2R,3S,4S)-5-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]-2,3,4-trihydroxypentyl] phosphate.
| Compound Name | [(2R,3S,4S)-5-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]-2,3,4-trihydroxypentyl] phosphate |
|---|---|
| PubChem CID | 135911927 |
| Molecular Formula | C9H16N5O8P-2 |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | [(2R,3S,4S)-5-[(2,5-diamino-6-oxo-1H-pyrimidin-4-yl)amino]-2,3,4-trihydroxypentyl] phosphate |
| SMILES | Nc1nc(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)([O-])[O-])c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C9H18N5O8P/c10-5-7(13-9(11)14-8(5)18)12-1-3(15)6(17)4(16)2-22-23(19,20)21/h3-4,6,15-17H,1-2,10H2,(H2,19,20,21)(H4,11,12,13,14,18)/p-2/t3-,4+,6-/m0/s1 |
| InChIKey | ACIVVGBVOVHFPQ-RPDRRWSUSA-L |
| XLogP | -4.73 |
| TPSA | 242.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|