C51H41N5O6 — CID 135912177
methyl 2-[[4-[10,15,20-tris(3-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoyl]amino]acetate (PubChem CID 135912177) has the molecular formula C51H41N5O6 and a molecular weight of 819.92 g/mol. Its IUPAC name is methyl 2-[[4-[10,15,20-tris(3-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[10,15,20-tris(3-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 135912177 |
| Molecular Formula | C51H41N5O6 |
| Molecular Weight | 819.92 g/mol |
| Exact Mass | 819.31 |
| IUPAC Name | methyl 2-[[4-[10,15,20-tris(3-methoxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(-c2c3nc(c(-c4cccc(OC)c4)c4ccc([nH]4)c(-c4cccc(OC)c4)c4nc(c(-c5cccc(OC)c5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C51H41N5O6/c1-59-35-11-5-8-32(26-35)48-40-20-18-38(53-40)47(30-14-16-31(17-15-30)51(58)52-29-46(57)62-4)39-19-21-41(54-39)49(33-9-6-12-36(27-33)60-2)43-23-25-45(56-43)50(44-24-22-42(48)55-44)34-10-7-13-37(28-34)61-3/h5-28,53,56H,29H2,1-4H3,(H,52,58)/b47-38-,47-39-,48-40-,48-42-,49-41-,49-43-,50-44-,50-45- |
| InChIKey | KFAQRUGTJSZEHU-PTVDXBRVSA-N |
| XLogP | 10.25 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.92 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |