C23H24N2O — CID 135912189
2-[N-[(1R,2R)-2-aminocyclohexyl]-C-naphthalen-1-ylcarbonimidoyl]phenol (PubChem CID 135912189) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[N-[(1R,2R)-2-aminocyclohexyl]-C-naphthalen-1-ylcarbonimidoyl]phenol.
| Compound Name | 2-[N-[(1R,2R)-2-aminocyclohexyl]-C-naphthalen-1-ylcarbonimidoyl]phenol |
|---|---|
| PubChem CID | 135912189 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-[N-[(1R,2R)-2-aminocyclohexyl]-C-naphthalen-1-ylcarbonimidoyl]phenol |
| SMILES | N[C@@H]1CCCC[C@H]1/N=C(\c1ccccc1O)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H24N2O/c24-20-13-4-5-14-21(20)25-23(19-11-3-6-15-22(19)26)18-12-7-9-16-8-1-2-10-17(16)18/h1-3,6-12,15,20-21,26H,4-5,13-14,24H2/b25-23-/t20-,21-/m1/s1 |
| InChIKey | IVKZCYNKTAKNIF-ZNTUXAMZSA-N |
| XLogP | 4.65 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|