C23H24N4O4S — CID 135913639
(6R,9S)-9-(3-methylthiophen-2-yl)-6-(3,4,5-trimethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135913639) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is (6R,9S)-9-(3-methylthiophen-2-yl)-6-(3,4,5-trimethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R,9S)-9-(3-methylthiophen-2-yl)-6-(3,4,5-trimethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135913639 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (6R,9S)-9-(3-methylthiophen-2-yl)-6-(3,4,5-trimethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cc([C@H]2CC(=O)C3=C(C2)Nc2ncnn2[C@@H]3c2sccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N4O4S/c1-12-5-6-32-22(12)20-19-15(26-23-24-11-25-27(20)23)7-13(8-16(19)28)14-9-17(29-2)21(31-4)18(10-14)30-3/h5-6,9-11,13,20H,7-8H2,1-4H3,(H,24,25,26)/t13-,20+/m1/s1 |
| InChIKey | DLXXVYCKENGYKE-XCLFUZPHSA-N |
| XLogP | 4.09 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |