C15H16N6O3 — CID 135914046
(5R)-7-amino-5-(2,3,4-trimethoxyphenyl)-4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile (PubChem CID 135914046) has the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is (5R)-7-amino-5-(2,3,4-trimethoxyphenyl)-4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile.
| Compound Name | (5R)-7-amino-5-(2,3,4-trimethoxyphenyl)-4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 135914046 |
| Molecular Formula | C15H16N6O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (5R)-7-amino-5-(2,3,4-trimethoxyphenyl)-4,5-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile |
| SMILES | COc1ccc([C@@H]2Nc3ncnn3C(N)=C2C#N)c(OC)c1OC |
| InChI | InChI=1S/C15H16N6O3/c1-22-10-5-4-8(12(23-2)13(10)24-3)11-9(6-16)14(17)21-15(20-11)18-7-19-21/h4-5,7,11H,17H2,1-3H3,(H,18,19,20)/t11-/m0/s1 |
| InChIKey | FLTNSIMREDORGM-NSHDSACASA-N |
| XLogP | 1.12 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |