C15H18N4O2 — CID 135914625
ethyl 4-[(dimethylamino)methyl]-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate (PubChem CID 135914625) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is ethyl 4-[(dimethylamino)methyl]-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate.
| Compound Name | ethyl 4-[(dimethylamino)methyl]-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 135914625 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 4-[(dimethylamino)methyl]-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
| SMILES | CCOC(=O)c1cc2c(ccn3cc(CN(C)C)nc23)[nH]1 |
| InChI | InChI=1S/C15H18N4O2/c1-4-21-15(20)13-7-11-12(17-13)5-6-19-9-10(8-18(2)3)16-14(11)19/h5-7,9,17H,4,8H2,1-3H3 |
| InChIKey | CVJWSSBRJINUFT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |