C19H31N5O3 — CID 135914875
trans-(1S,3R)-3-N,3-N,1,2,2-pentamethyl-1-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]cyclopentane-1,3-dicarboxamide (PubChem CID 135914875) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is trans-(1S,3R)-3-N,3-N,1,2,2-pentamethyl-1-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]cyclopentane-1,3-dicarboxamide.
| Compound Name | trans-(1S,3R)-3-N,3-N,1,2,2-pentamethyl-1-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]cyclopentane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 135914875 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | trans-(1S,3R)-3-N,3-N,1,2,2-pentamethyl-1-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]cyclopentane-1,3-dicarboxamide |
| SMILES | Cc1cc(=O)[nH]c(NCCNC(=O)[C@@]2(C)CC[C@@H](C(=O)N(C)C)C2(C)C)n1 |
| InChI | InChI=1S/C19H31N5O3/c1-12-11-14(25)23-17(22-12)21-10-9-20-16(27)19(4)8-7-13(18(19,2)3)15(26)24(5)6/h11,13H,7-10H2,1-6H3,(H,20,27)(H2,21,22,23,25)/t13-,19+/m0/s1 |
| InChIKey | ZYRFFVOZHUONMS-ORAYPTAESA-N |
| XLogP | 1.14 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|