C18H15ClN4O3 — CID 135915051
3-chloro-N'-[3-(4-oxo-3H-quinazolin-2-yl)propanoyl]benzohydrazide (PubChem CID 135915051) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is 3-chloro-N'-[3-(4-oxo-3H-quinazolin-2-yl)propanoyl]benzohydrazide.
| Compound Name | 3-chloro-N'-[3-(4-oxo-3H-quinazolin-2-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 135915051 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3-chloro-N'-[3-(4-oxo-3H-quinazolin-2-yl)propanoyl]benzohydrazide |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15ClN4O3/c19-12-5-3-4-11(10-12)17(25)23-22-16(24)9-8-15-20-14-7-2-1-6-13(14)18(26)21-15/h1-7,10H,8-9H2,(H,22,24)(H,23,25)(H,20,21,26) |
| InChIKey | MBERQSRLHIHUOX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|