C12H15FN4O4 — CID 135915158
8-[(2R,3R,4R,5S)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1,7-dihydropurin-6-one (PubChem CID 135915158) has the molecular formula C12H15FN4O4 and a molecular weight of 298.27 g/mol. Its IUPAC name is 8-[(2R,3R,4R,5S)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1,7-dihydropurin-6-one.
| Compound Name | 8-[(2R,3R,4R,5S)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 135915158 |
| Molecular Formula | C12H15FN4O4 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 8-[(2R,3R,4R,5S)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1,7-dihydropurin-6-one |
| SMILES | C[C@@]1(O)[C@H](CO)O[C@H](c2nc3nc[nH]c(=O)c3[nH]2)[C@@]1(C)F |
| InChI | InChI=1S/C12H15FN4O4/c1-11(13)7(21-5(3-18)12(11,2)20)9-16-6-8(17-9)14-4-15-10(6)19/h4-5,7,18,20H,3H2,1-2H3,(H2,14,15,16,17,19)/t5-,7+,11+,12+/m0/s1 |
| InChIKey | LUVLQSIVFLANID-KCXRKLOYSA-N |
| XLogP | -0.44 |
| TPSA | 124.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |