About 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide
2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide (PubChem CID 135915291) has the molecular formula C7H8N6O2
and a molecular weight of 208.18 g/mol. Its IUPAC name is 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide.
Molecular Properties
| Compound Name | 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide |
| PubChem CID | 135915291 |
| Molecular Formula | C7H8N6O2 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide |
| SMILES | NC(=O)C1=Nc2c(nc(N)[nH]c2=O)NC1 |
| InChI | InChI=1S/C7H8N6O2/c8-4(14)2-1-10-5-3(11-2)6(15)13-7(9)12-5/h1H2,(H2,8,14)(H4,9,10,12,13,15) |
| InChIKey | DLTHRVDCJOFAHC-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 139.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide?
The IUPAC name of 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide (CID 135915291) is 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide.
What is the SMILES notation for 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide?
The canonical SMILES for 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide is NC(=O)C1=Nc2c(nc(N)[nH]c2=O)NC1.
What is the InChIKey of 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide?
The InChIKey is DLTHRVDCJOFAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6O2/c8-4(14)2-1-10-5-3(11-2)6(15)13-7(9)12-5/h1H2,(H2,8,14)(H4,9,10,12,13,15).
What are the key properties of 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide?
2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide has a molecular weight of 208.18 g/mol, XLogP of -1.66, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-oxo-7,8-dihydro-3H-pteridine-6-carboxamide is sourced from PubChem (CID 135915291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).