About 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine
2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine (PubChem CID 135915305) has the molecular formula C20H21N5O4
and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine |
| PubChem CID | 135915305 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine |
| SMILES | COc1ccc(-c2cnc(N=C(N)N)nc2-c2c(O)cc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C20H21N5O4/c1-27-12-6-4-11(5-7-12)14-10-23-20(25-19(21)22)24-18(14)17-15(26)8-13(28-2)9-16(17)29-3/h4-10,26H,1-3H3,(H4,21,22,23,24,25) |
| InChIKey | FFCXEZDCDALUJB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine?
The IUPAC name of 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine (CID 135915305) is 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine.
What is the SMILES notation for 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine?
The canonical SMILES for 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine is COc1ccc(-c2cnc(N=C(N)N)nc2-c2c(O)cc(OC)cc2OC)cc1.
What is the InChIKey of 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine?
The InChIKey is FFCXEZDCDALUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N5O4/c1-27-12-6-4-11(5-7-12)14-10-23-20(25-19(21)22)24-18(14)17-15(26)8-13(28-2)9-16(17)29-3/h4-10,26H,1-3H3,(H4,21,22,23,24,25).
What are the key properties of 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine?
2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine has a molecular weight of 395.42 g/mol, XLogP of 2.45, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-hydroxy-4,6-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrimidin-2-yl]guanidine is sourced from PubChem (CID 135915305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).