C22H20N4O4S — CID 135915559
4-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135915559) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135915559 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(-c2n[nH]c(=S)n2/N=C\c2c(O)ccc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C22H20N4O4S/c1-28-18-10-14(11-19(29-2)20(18)30-3)21-24-25-22(31)26(21)23-12-16-15-7-5-4-6-13(15)8-9-17(16)27/h4-12,27H,1-3H3,(H,25,31)/b23-12- |
| InChIKey | GTONBXJDOLKZJE-FMCGGJTJSA-N |
| XLogP | 4.37 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|