C19H14F4N4O — CID 135916575
2-pyridin-3-yl-6-[(2,3,5,6-tetrafluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135916575) has the molecular formula C19H14F4N4O and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-pyridin-3-yl-6-[(2,3,5,6-tetrafluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-pyridin-3-yl-6-[(2,3,5,6-tetrafluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135916575 |
| Molecular Formula | C19H14F4N4O |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-pyridin-3-yl-6-[(2,3,5,6-tetrafluorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2cccnc2)nc2c1CN(Cc1c(F)c(F)cc(F)c1F)CC2 |
| InChI | InChI=1S/C19H14F4N4O/c20-13-6-14(21)17(23)12(16(13)22)9-27-5-3-15-11(8-27)19(28)26-18(25-15)10-2-1-4-24-7-10/h1-2,4,6-7H,3,5,8-9H2,(H,25,26,28) |
| InChIKey | MIZAHBGNEYHVAI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|