C21H21FN4O2 — CID 135917921
2-(4-aminophenyl)-6-[(2-fluoro-6-methoxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135917921) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-[(2-fluoro-6-methoxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-aminophenyl)-6-[(2-fluoro-6-methoxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135917921 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-(4-aminophenyl)-6-[(2-fluoro-6-methoxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1cccc(F)c1CN1CCc2nc(-c3ccc(N)cc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C21H21FN4O2/c1-28-19-4-2-3-17(22)15(19)11-26-10-9-18-16(12-26)21(27)25-20(24-18)13-5-7-14(23)8-6-13/h2-8H,9-12,23H2,1H3,(H,24,25,27) |
| InChIKey | ZPLLBVOWXOPMSJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|