C21H17F3N4O4 — CID 135918002
6-[(2-hydroxy-3-nitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135918002) has the molecular formula C21H17F3N4O4 and a molecular weight of 446.39 g/mol. Its IUPAC name is 6-[(2-hydroxy-3-nitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2-hydroxy-3-nitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135918002 |
| Molecular Formula | C21H17F3N4O4 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 6-[(2-hydroxy-3-nitrophenyl)methyl]-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(C(F)(F)F)cc2)nc2c1CN(Cc1cccc([N+](=O)[O-])c1O)CC2 |
| InChI | InChI=1S/C21H17F3N4O4/c22-21(23,24)14-6-4-12(5-7-14)19-25-16-8-9-27(11-15(16)20(30)26-19)10-13-2-1-3-17(18(13)29)28(31)32/h1-7,29H,8-11H2,(H,25,26,30) |
| InChIKey | SRUXQZWDCULTBE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|