C22H25N3O4 — CID 135918296
6-[(3,4-diethoxyphenyl)methyl]-2-(furan-2-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135918296) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 6-[(3,4-diethoxyphenyl)methyl]-2-(furan-2-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(3,4-diethoxyphenyl)methyl]-2-(furan-2-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135918296 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 6-[(3,4-diethoxyphenyl)methyl]-2-(furan-2-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCOc1ccc(CN2CCc3nc(-c4ccco4)[nH]c(=O)c3C2)cc1OCC |
| InChI | InChI=1S/C22H25N3O4/c1-3-27-18-8-7-15(12-20(18)28-4-2)13-25-10-9-17-16(14-25)22(26)24-21(23-17)19-6-5-11-29-19/h5-8,11-12H,3-4,9-10,13-14H2,1-2H3,(H,23,24,26) |
| InChIKey | CCNXUNDBIKGTIO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |