C14H14ClFN4O2 — CID 135918790
2-amino-6-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135918790) has the molecular formula C14H14ClFN4O2 and a molecular weight of 324.74 g/mol. Its IUPAC name is 2-amino-6-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-6-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135918790 |
| Molecular Formula | C14H14ClFN4O2 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-amino-6-[(3-chloro-5-fluoro-2-hydroxyphenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)CN(Cc1cc(F)cc(Cl)c1O)CC2 |
| InChI | InChI=1S/C14H14ClFN4O2/c15-10-4-8(16)3-7(12(10)21)5-20-2-1-11-9(6-20)13(22)19-14(17)18-11/h3-4,21H,1-2,5-6H2,(H3,17,18,19,22) |
| InChIKey | YCNPGDOLLNRAMM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|