C20H20F4N4O — CID 135919786
6-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135919786) has the molecular formula C20H20F4N4O and a molecular weight of 408.40 g/mol. Its IUPAC name is 6-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135919786 |
| Molecular Formula | C20H20F4N4O |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 6-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2=NCCCC2)nc2c1CN(Cc1ccc(F)c(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C20H20F4N4O/c21-15-5-4-12(9-14(15)20(22,23)24)10-28-8-6-16-13(11-28)19(29)27-18(26-16)17-3-1-2-7-25-17/h4-5,9H,1-3,6-8,10-11H2,(H,26,27,29) |
| InChIKey | LUBOISFQKJYWNS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |