C22H21Cl2N3O3 — CID 135920197
6-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2-(4-chlorophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135920197) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is 6-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2-(4-chlorophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2-(4-chlorophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135920197 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 6-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2-(4-chlorophenyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1cc(Cl)cc(CN2CCc3nc(-c4ccc(Cl)cc4)[nH]c(=O)c3C2)c1OC |
| InChI | InChI=1S/C22H21Cl2N3O3/c1-29-19-10-16(24)9-14(20(19)30-2)11-27-8-7-18-17(12-27)22(28)26-21(25-18)13-3-5-15(23)6-4-13/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,25,26,28) |
| InChIKey | SUQBPZBKYJPRDX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |