C19H15F3N4O2S — CID 135920563
2-[(2Z,5S)-4-oxo-2-[(Z)-[3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 135920563) has the molecular formula C19H15F3N4O2S and a molecular weight of 420.42 g/mol. Its IUPAC name is 2-[(2Z,5S)-4-oxo-2-[(Z)-[3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(2Z,5S)-4-oxo-2-[(Z)-[3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135920563 |
| Molecular Formula | C19H15F3N4O2S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-[(2Z,5S)-4-oxo-2-[(Z)-[3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(C[C@@H]1S/C(=N\N=C/c2cccc(C(F)(F)F)c2)NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H15F3N4O2S/c20-19(21,22)13-6-4-5-12(9-13)11-23-26-18-25-17(28)15(29-18)10-16(27)24-14-7-2-1-3-8-14/h1-9,11,15H,10H2,(H,24,27)(H,25,26,28)/b23-11-/t15-/m0/s1 |
| InChIKey | DRYZNISWPWVPOK-CEABSUDRSA-N |
| XLogP | 3.66 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|