About 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one
1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one (PubChem CID 135921138) has the molecular formula C8H9N5O
and a molecular weight of 191.19 g/mol. Its IUPAC name is 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one.
Molecular Properties
| Compound Name | 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one |
| PubChem CID | 135921138 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one |
| SMILES | Cn1cnc2nc(=O)n3c(c21)NCC3 |
| InChI | InChI=1S/C8H9N5O/c1-12-4-10-6-5(12)7-9-2-3-13(7)8(14)11-6/h4,9H,2-3H2,1H3 |
| InChIKey | AJTLNYPOVLCLIT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one?
The IUPAC name of 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one (CID 135921138) is 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one.
What is the SMILES notation for 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one?
The canonical SMILES for 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one is Cn1cnc2nc(=O)n3c(c21)NCC3.
What is the InChIKey of 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one?
The InChIKey is AJTLNYPOVLCLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O/c1-12-4-10-6-5(12)7-9-2-3-13(7)8(14)11-6/h4,9H,2-3H2,1H3.
What are the key properties of 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one?
1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one has a molecular weight of 191.19 g/mol, XLogP of -0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one is sourced from PubChem (CID 135921138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).