C33H42N4 — CID 135921141
N-[7-(2,3,4,8a,10,10a-hexahydro-1H-acridin-9-ylideneamino)heptyl]-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 135921141) has the molecular formula C33H42N4 and a molecular weight of 494.73 g/mol. Its IUPAC name is N-[7-(2,3,4,8a,10,10a-hexahydro-1H-acridin-9-ylideneamino)heptyl]-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-[7-(2,3,4,8a,10,10a-hexahydro-1H-acridin-9-ylideneamino)heptyl]-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 135921141 |
| Molecular Formula | C33H42N4 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | N-[7-(2,3,4,8a,10,10a-hexahydro-1H-acridin-9-ylideneamino)heptyl]-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | C1=CC2NC3=C(CCCC3)/C(=N/CCCCCCCNc3c4c(nc5ccccc35)CCCC4)C2C=C1 |
| InChI | InChI=1S/C33H42N4/c1(2-12-22-34-32-24-14-4-8-18-28(24)36-29-19-9-5-15-25(29)32)3-13-23-35-33-26-16-6-10-20-30(26)37-31-21-11-7-17-27(31)33/h4,6,8,10,14,16,18,20,24,28,36H,1-3,5,7,9,11-13,15,17,19,21-23H2,(H,35,37)/b34-32+ |
| InChIKey | XIORSHWFXQKUNH-NWBJSICCSA-N |
| XLogP | 7.46 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|