About 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol
2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol (PubChem CID 135921475) has the molecular formula C20H21FN4O3
and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol.
Molecular Properties
| Compound Name | 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol |
| PubChem CID | 135921475 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol |
| SMILES | COc1cc2nc(-c3cc(F)ccc3O)nc(N[C@H]3CCNC3)c2cc1OC |
| InChI | InChI=1S/C20H21FN4O3/c1-27-17-8-13-15(9-18(17)28-2)24-20(14-7-11(21)3-4-16(14)26)25-19(13)23-12-5-6-22-10-12/h3-4,7-9,12,22,26H,5-6,10H2,1-2H3,(H,23,24,25)/t12-/m0/s1 |
| InChIKey | GHWMQXIAILGGTF-LBPRGKRZSA-N |
| XLogP | 2.93 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol?
The IUPAC name of 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol (CID 135921475) is 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol.
What is the SMILES notation for 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol?
The canonical SMILES for 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol is COc1cc2nc(-c3cc(F)ccc3O)nc(N[C@H]3CCNC3)c2cc1OC.
What is the InChIKey of 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol?
The InChIKey is GHWMQXIAILGGTF-LBPRGKRZSA-N. The full InChI is InChI=1S/C20H21FN4O3/c1-27-17-8-13-15(9-18(17)28-2)24-20(14-7-11(21)3-4-16(14)26)25-19(13)23-12-5-6-22-10-12/h3-4,7-9,12,22,26H,5-6,10H2,1-2H3,(H,23,24,25)/t12-/m0/s1.
What are the key properties of 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol?
2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol has a molecular weight of 384.41 g/mol, XLogP of 2.93, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6,7-dimethoxy-4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]-4-fluorophenol is sourced from PubChem (CID 135921475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).