About 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol
4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol (PubChem CID 135921502) has the molecular formula C19H19FN4O2
and a molecular weight of 354.39 g/mol. Its IUPAC name is 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol.
Molecular Properties
| Compound Name | 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol |
| PubChem CID | 135921502 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol |
| SMILES | OC[C@H]1C[C@H](Nc2nc(-c3cc(F)ccc3O)nc3ccccc23)CN1 |
| InChI | InChI=1S/C19H19FN4O2/c20-11-5-6-17(26)15(7-11)19-23-16-4-2-1-3-14(16)18(24-19)22-12-8-13(10-25)21-9-12/h1-7,12-13,21,25-26H,8-10H2,(H,22,23,24)/t12-,13+/m0/s1 |
| InChIKey | OBGJEWVFHZZEGA-QWHCGFSZSA-N |
| XLogP | 2.28 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol?
The IUPAC name of 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol (CID 135921502) is 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol.
What is the SMILES notation for 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol?
The canonical SMILES for 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol is OC[C@H]1C[C@H](Nc2nc(-c3cc(F)ccc3O)nc3ccccc23)CN1.
What is the InChIKey of 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol?
The InChIKey is OBGJEWVFHZZEGA-QWHCGFSZSA-N. The full InChI is InChI=1S/C19H19FN4O2/c20-11-5-6-17(26)15(7-11)19-23-16-4-2-1-3-14(16)18(24-19)22-12-8-13(10-25)21-9-12/h1-7,12-13,21,25-26H,8-10H2,(H,22,23,24)/t12-,13+/m0/s1.
What are the key properties of 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol?
4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol has a molecular weight of 354.39 g/mol, XLogP of 2.28, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-[4-[[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol is sourced from PubChem (CID 135921502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).