C20H14BrClN2O4S — CID 135921848
5-[[(5Z)-5-[(5-bromo-2-prop-2-enoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-chlorobenzoic acid (PubChem CID 135921848) has the molecular formula C20H14BrClN2O4S and a molecular weight of 493.77 g/mol. Its IUPAC name is 5-[[(5Z)-5-[(5-bromo-2-prop-2-enoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-chlorobenzoic acid.
| Compound Name | 5-[[(5Z)-5-[(5-bromo-2-prop-2-enoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 135921848 |
| Molecular Formula | C20H14BrClN2O4S |
| Molecular Weight | 493.77 g/mol |
| Exact Mass | 491.95 |
| IUPAC Name | 5-[[(5Z)-5-[(5-bromo-2-prop-2-enoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-2-chlorobenzoic acid |
| SMILES | C=CCOc1ccc(Br)cc1/C=C1\S/C(=N/c2ccc(Cl)c(C(=O)O)c2)NC1=O |
| InChI | InChI=1S/C20H14BrClN2O4S/c1-2-7-28-16-6-3-12(21)8-11(16)9-17-18(25)24-20(29-17)23-13-4-5-15(22)14(10-13)19(26)27/h2-6,8-10H,1,7H2,(H,26,27)(H,23,24,25)/b17-9- |
| InChIKey | MQSHNYJRZDTWIS-MFOYZWKCSA-N |
| XLogP | 5.26 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|