About 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol
2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol (PubChem CID 135921949) has the molecular formula C22H19NO3
and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol |
| PubChem CID | 135921949 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol |
| SMILES | COc1c(C)cc(-c2ccc3nc(-c4ccccc4O)oc3c2)cc1C |
| InChI | InChI=1S/C22H19NO3/c1-13-10-16(11-14(2)21(13)25-3)15-8-9-18-20(12-15)26-22(23-18)17-6-4-5-7-19(17)24/h4-12,24H,1-3H3 |
| InChIKey | ZMUTXGVCCIEYMF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol?
The IUPAC name of 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol (CID 135921949) is 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol.
What is the SMILES notation for 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol?
The canonical SMILES for 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol is COc1c(C)cc(-c2ccc3nc(-c4ccccc4O)oc3c2)cc1C.
What is the InChIKey of 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol?
The InChIKey is ZMUTXGVCCIEYMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO3/c1-13-10-16(11-14(2)21(13)25-3)15-8-9-18-20(12-15)26-22(23-18)17-6-4-5-7-19(17)24/h4-12,24H,1-3H3.
What are the key properties of 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol?
2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol has a molecular weight of 345.40 g/mol, XLogP of 5.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenol is sourced from PubChem (CID 135921949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).