C20H21N3O2S — CID 1359220
12-benzyl-4,4-dimethyl-5-oxa-8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-one (PubChem CID 1359220) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 12-benzyl-4,4-dimethyl-5-oxa-8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-one.
| Compound Name | 12-benzyl-4,4-dimethyl-5-oxa-8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-one |
|---|---|
| PubChem CID | 1359220 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 12-benzyl-4,4-dimethyl-5-oxa-8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-one |
| SMILES | CC1(C)Cc2c(sc3nc4n(c(=O)c23)CCN4Cc2ccccc2)CO1 |
| InChI | InChI=1S/C20H21N3O2S/c1-20(2)10-14-15(12-25-20)26-17-16(14)18(24)23-9-8-22(19(23)21-17)11-13-6-4-3-5-7-13/h3-7H,8-12H2,1-2H3 |
| InChIKey | JRIKIFJIILDTSX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |