C15H23N3O2S — CID 135922153
3-butyl-1-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-1-methylthiourea (PubChem CID 135922153) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-butyl-1-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-1-methylthiourea.
| Compound Name | 3-butyl-1-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-1-methylthiourea |
|---|---|
| PubChem CID | 135922153 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-butyl-1-[(Z)-(3-ethoxy-2-hydroxyphenyl)methylideneamino]-1-methylthiourea |
| SMILES | CCCCNC(=S)N(C)/N=C\c1cccc(OCC)c1O |
| InChI | InChI=1S/C15H23N3O2S/c1-4-6-10-16-15(21)18(3)17-11-12-8-7-9-13(14(12)19)20-5-2/h7-9,11,19H,4-6,10H2,1-3H3,(H,16,21)/b17-11- |
| InChIKey | SJICSSTWPMQQLJ-BOPFTXTBSA-N |
| XLogP | 2.73 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|