C19H15ClN4OS — CID 135922334
(5Z)-5-[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135922334) has the molecular formula C19H15ClN4OS and a molecular weight of 382.88 g/mol. Its IUPAC name is (5Z)-5-[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135922334 |
| Molecular Formula | C19H15ClN4OS |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (5Z)-5-[(2-chloroimidazo[1,2-a]pyridin-3-yl)methylidene]-2-(2,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3c(Cl)nc4ccccn34)S2)c(C)c1 |
| InChI | InChI=1S/C19H15ClN4OS/c1-11-6-7-13(12(2)9-11)21-19-23-18(25)15(26-19)10-14-17(20)22-16-5-3-4-8-24(14)16/h3-10H,1-2H3,(H,21,23,25)/b15-10- |
| InChIKey | VTHAIOVLEYPUMI-GDNBJRDFSA-N |
| XLogP | 4.50 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|