About benzo[cd]indol-3-ol
benzo[cd]indol-3-ol (PubChem CID 135922640) has the molecular formula C11H7NO
and a molecular weight of 169.18 g/mol. Its IUPAC name is benzo[cd]indol-3-ol.
Molecular Properties
| Compound Name | benzo[cd]indol-3-ol |
| PubChem CID | 135922640 |
| Molecular Formula | C11H7NO |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | benzo[cd]indol-3-ol |
| SMILES | Oc1ccc2cccc3c2c1C=N3 |
| InChI | InChI=1S/C11H7NO/c13-10-5-4-7-2-1-3-9-11(7)8(10)6-12-9/h1-6,13H |
| InChIKey | OPEWEGSXHBOCSP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[cd]indol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[cd]indol-3-ol?
The IUPAC name of benzo[cd]indol-3-ol (CID 135922640) is benzo[cd]indol-3-ol.
What is the SMILES notation for benzo[cd]indol-3-ol?
The canonical SMILES for benzo[cd]indol-3-ol is Oc1ccc2cccc3c2c1C=N3.
What is the InChIKey of benzo[cd]indol-3-ol?
The InChIKey is OPEWEGSXHBOCSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO/c13-10-5-4-7-2-1-3-9-11(7)8(10)6-12-9/h1-6,13H.
What are the key properties of benzo[cd]indol-3-ol?
benzo[cd]indol-3-ol has a molecular weight of 169.18 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[cd]indol-3-ol is sourced from PubChem (CID 135922640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).