C22H30N6O2S — CID 135922829
(2S)-N-(ethylcarbamoyl)-2-[[4-hexyl-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 135922829) has the molecular formula C22H30N6O2S and a molecular weight of 442.59 g/mol. Its IUPAC name is (2S)-N-(ethylcarbamoyl)-2-[[4-hexyl-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(ethylcarbamoyl)-2-[[4-hexyl-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 135922829 |
| Molecular Formula | C22H30N6O2S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (2S)-N-(ethylcarbamoyl)-2-[[4-hexyl-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CCCCCCn1c(S[C@@H](C)C(=O)NC(=O)NCC)nnc1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H30N6O2S/c1-4-6-7-10-13-28-19(17-14-24-18-12-9-8-11-16(17)18)26-27-22(28)31-15(3)20(29)25-21(30)23-5-2/h8-9,11-12,14-15,24H,4-7,10,13H2,1-3H3,(H2,23,25,29,30)/t15-/m0/s1 |
| InChIKey | YLDFJLJVXICOMU-HNNXBMFYSA-N |
| XLogP | 4.33 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|