C35H23N3O2 — CID 135923267
3-(2,6-dipyridin-2-yl-4-pyridinyl)-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol (PubChem CID 135923267) has the molecular formula C35H23N3O2 and a molecular weight of 517.59 g/mol. Its IUPAC name is 3-(2,6-dipyridin-2-yl-4-pyridinyl)-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
| Compound Name | 3-(2,6-dipyridin-2-yl-4-pyridinyl)-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 135923267 |
| Molecular Formula | C35H23N3O2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 3-(2,6-dipyridin-2-yl-4-pyridinyl)-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1-c1c(O)c(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc2ccccc12 |
| InChI | InChI=1S/C35H23N3O2/c39-32-16-15-22-9-1-3-11-25(22)33(32)34-26-12-4-2-10-23(26)19-27(35(34)40)24-20-30(28-13-5-7-17-36-28)38-31(21-24)29-14-6-8-18-37-29/h1-21,39-40H |
| InChIKey | SILFIBDMGJIDEK-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |