About 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one
7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135923581) has the molecular formula C22H17Cl2N3O
and a molecular weight of 410.30 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 135923581 |
| Molecular Formula | C22H17Cl2N3O |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)c1nc2nc(-c3ccccc3Cl)c(-c3ccc(Cl)cc3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H17Cl2N3O/c1-12(2)20-26-21-17(22(28)27-20)11-16(13-7-9-14(23)10-8-13)19(25-21)15-5-3-4-6-18(15)24/h3-12H,1-2H3,(H,25,26,27,28) |
| InChIKey | KPEQDIMLMKNWLV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one (CID 135923581) is 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one is CC(C)c1nc2nc(-c3ccccc3Cl)c(-c3ccc(Cl)cc3)cc2c(=O)[nH]1.
What is the InChIKey of 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is KPEQDIMLMKNWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Cl2N3O/c1-12(2)20-26-21-17(22(28)27-20)11-16(13-7-9-14(23)10-8-13)19(25-21)15-5-3-4-6-18(15)24/h3-12H,1-2H3,(H,25,26,27,28).
What are the key properties of 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one?
7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 410.30 g/mol, XLogP of 6.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-chlorophenyl)-6-(4-chlorophenyl)-2-propan-2-yl-3H-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 135923581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).