About 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one
7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135923696) has the molecular formula C25H14Cl3N3O
and a molecular weight of 478.77 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 135923696 |
| Molecular Formula | C25H14Cl3N3O |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(Cl)cc2)nc2nc(-c3ccccc3Cl)c(-c3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C25H14Cl3N3O/c26-16-9-5-14(6-10-16)19-13-20-24(29-22(19)18-3-1-2-4-21(18)28)30-23(31-25(20)32)15-7-11-17(27)12-8-15/h1-13H,(H,29,30,31,32) |
| InChIKey | ADTDLLKEQWBPQJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one (CID 135923696) is 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one is O=c1[nH]c(-c2ccc(Cl)cc2)nc2nc(-c3ccccc3Cl)c(-c3ccc(Cl)cc3)cc12.
What is the InChIKey of 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is ADTDLLKEQWBPQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H14Cl3N3O/c26-16-9-5-14(6-10-16)19-13-20-24(29-22(19)18-3-1-2-4-21(18)28)30-23(31-25(20)32)15-7-11-17(27)12-8-15/h1-13H,(H,29,30,31,32).
What are the key properties of 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one?
7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 478.77 g/mol, XLogP of 7.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-chlorophenyl)-2,6-bis(4-chlorophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 135923696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).