C21H31N3O2S — CID 135923712
N-tert-butyl-1-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-thiadiazol-5-yl]methanimine oxide (PubChem CID 135923712) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is N-tert-butyl-1-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-thiadiazol-5-yl]methanimine oxide.
| Compound Name | N-tert-butyl-1-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-thiadiazol-5-yl]methanimine oxide |
|---|---|
| PubChem CID | 135923712 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-tert-butyl-1-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-thiadiazol-5-yl]methanimine oxide |
| SMILES | CC(C)(C)c1cc(-c2nsc(/C=[N+](\[O-])C(C)(C)C)n2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H31N3O2S/c1-19(2,3)14-10-13(11-15(17(14)25)20(4,5)6)18-22-16(27-23-18)12-24(26)21(7,8)9/h10-12,25H,1-9H3/b24-12- |
| InChIKey | GOPCJWZPWQAJQU-MSXFZWOLSA-N |
| XLogP | 5.23 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|