C20H23N3O3S — CID 135923962
3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[[4-(methoxymethyl)phenyl]methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 135923962) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[[4-(methoxymethyl)phenyl]methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[[4-(methoxymethyl)phenyl]methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135923962 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-[[4-(methoxymethyl)phenyl]methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COCc1ccc(Cn2c(-c3cc(C(C)C)c(O)cc3O)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-12(2)15-8-16(18(25)9-17(15)24)19-21-22-20(27)23(19)10-13-4-6-14(7-5-13)11-26-3/h4-9,12,24-25H,10-11H2,1-3H3,(H,22,27) |
| InChIKey | UCWJGMVPJNXPME-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|